C35H38ClFN4O6 — CID 143596590
4-(4-chloro-N-methylanilino)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-formylbutanamide (PubChem CID 143596590) has the molecular formula C35H38ClFN4O6 and a molecular weight of 665.16 g/mol. Its IUPAC name is 4-(4-chloro-N-methylanilino)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-formylbutanamide.
| Compound Name | 4-(4-chloro-N-methylanilino)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-formylbutanamide |
|---|---|
| PubChem CID | 143596590 |
| Molecular Formula | C35H38ClFN4O6 |
| Molecular Weight | 665.16 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | 4-(4-chloro-N-methylanilino)-N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-formylbutanamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C(C=O)CCN(C)c4ccc(Cl)cc4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C35H38ClFN4O6/c1-40(27-7-4-25(36)5-8-27)14-11-24(23-42)35(43)39-26-6-9-32(29(37)20-26)47-31-10-12-38-30-22-34(33(44-2)21-28(30)31)46-17-3-13-41-15-18-45-19-16-41/h4-10,12,20-24H,3,11,13-19H2,1-2H3,(H,39,43) |
| InChIKey | ODAFKHSOTXEUKJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 102.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.16 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|