C34H38FN5O5 — CID 90646072
N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]acetamide (PubChem CID 90646072) has the molecular formula C34H38FN5O5 and a molecular weight of 615.71 g/mol. Its IUPAC name is N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]acetamide.
| Compound Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 90646072 |
| Molecular Formula | C34H38FN5O5 |
| Molecular Weight | 615.71 g/mol |
| Exact Mass | 615.29 |
| IUPAC Name | N-[(E)-[4-(dimethylamino)phenyl]methylideneamino]-2-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]acetamide |
| SMILES | COc1cc2c(Oc3ccc(CC(=O)N/N=C/c4ccc(N(C)C)cc4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C34H38FN5O5/c1-39(2)26-8-5-24(6-9-26)23-37-38-34(41)20-25-7-10-31(28(35)19-25)45-30-11-12-36-29-22-33(32(42-3)21-27(29)30)44-16-4-13-40-14-17-43-18-15-40/h5-12,19,21-23H,4,13-18,20H2,1-3H3,(H,38,41)/b37-23+ |
| InChIKey | YLEXTSQAZFWJDF-GUBAARJWSA-N |
| XLogP | 5.03 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|