C31H31F2N5O5 — CID 72723925
1-[(E)-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methylideneamino]-3-(3-fluorophenyl)urea (PubChem CID 72723925) has the molecular formula C31H31F2N5O5 and a molecular weight of 591.62 g/mol. Its IUPAC name is 1-[(E)-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methylideneamino]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(E)-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methylideneamino]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 72723925 |
| Molecular Formula | C31H31F2N5O5 |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 1-[(E)-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]methylideneamino]-3-(3-fluorophenyl)urea |
| SMILES | COc1cc2c(Oc3ccc(/C=N/NC(=O)Nc4cccc(F)c4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C31H31F2N5O5/c1-40-29-18-24-26(19-30(29)42-13-3-10-38-11-14-41-15-12-38)34-9-8-27(24)43-28-7-6-21(16-25(28)33)20-35-37-31(39)36-23-5-2-4-22(32)17-23/h2,4-9,16-20H,3,10-15H2,1H3,(H2,36,37,39)/b35-20+ |
| InChIKey | RUPKLGFGRRAYRC-JEPNHJGPSA-N |
| XLogP | 5.57 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|