C32H35FN6O3S — CID 71678871
1-[(E)-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]-3-phenylthiourea (PubChem CID 71678871) has the molecular formula C32H35FN6O3S and a molecular weight of 602.74 g/mol. Its IUPAC name is 1-[(E)-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]-3-phenylthiourea.
| Compound Name | 1-[(E)-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 71678871 |
| Molecular Formula | C32H35FN6O3S |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 1-[(E)-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperazin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]-3-phenylthiourea |
| SMILES | COc1cc2c(Oc3ccc(/C=N/NC(=S)Nc4ccccc4)cc3F)ccnc2cc1OCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C32H35FN6O3S/c1-38-14-16-39(17-15-38)13-6-18-41-31-21-27-25(20-30(31)40-2)28(11-12-34-27)42-29-10-9-23(19-26(29)33)22-35-37-32(43)36-24-7-4-3-5-8-24/h3-5,7-12,19-22H,6,13-18H2,1-2H3,(H2,36,37,43)/b35-22+ |
| InChIKey | YPRKSUKTPJVRJA-FADJLKOXSA-N |
| XLogP | 5.51 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|