C25H30FN5O3S — CID 118468080
1-amino-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]thiourea (PubChem CID 118468080) has the molecular formula C25H30FN5O3S and a molecular weight of 499.61 g/mol. Its IUPAC name is 1-amino-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]thiourea.
| Compound Name | 1-amino-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]thiourea |
|---|---|
| PubChem CID | 118468080 |
| Molecular Formula | C25H30FN5O3S |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 1-amino-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]thiourea |
| SMILES | COc1cc2c(Oc3ccc(NC(=S)NN)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C25H30FN5O3S/c1-32-23-15-18-20(16-24(23)33-13-5-12-31-10-3-2-4-11-31)28-9-8-21(18)34-22-7-6-17(14-19(22)26)29-25(35)30-27/h6-9,14-16H,2-5,10-13,27H2,1H3,(H2,29,30,35) |
| InChIKey | VZDABDRSWWTEPE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|