C36H35FN4O4 — CID 73355490
N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-4-(2-methylphenyl)pyridine-2-carboxamide (PubChem CID 73355490) has the molecular formula C36H35FN4O4 and a molecular weight of 606.70 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-4-(2-methylphenyl)pyridine-2-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-4-(2-methylphenyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 73355490 |
| Molecular Formula | C36H35FN4O4 |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.26 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-4-(2-methylphenyl)pyridine-2-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4cc(-c5ccccc5C)ccn4)cc3F)ccnc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C36H35FN4O4/c1-24-8-3-4-9-27(24)25-12-14-39-31(20-25)36(42)40-26-10-11-33(29(37)21-26)45-32-13-15-38-30-23-35(34(43-2)22-28(30)32)44-19-7-18-41-16-5-6-17-41/h3-4,8-15,20-23H,5-7,16-19H2,1-2H3,(H,40,42) |
| InChIKey | KLVOHYIGTKDTDT-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|