C25H28FN3O4 — CID 130443825
N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]formamide (PubChem CID 130443825) has the molecular formula C25H28FN3O4 and a molecular weight of 453.51 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]formamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]formamide |
|---|---|
| PubChem CID | 130443825 |
| Molecular Formula | C25H28FN3O4 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]formamide |
| SMILES | COc1cc2c(Oc3ccc(NC=O)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C25H28FN3O4/c1-31-24-15-19-21(16-25(24)32-13-5-12-29-10-3-2-4-11-29)27-9-8-22(19)33-23-7-6-18(28-17-30)14-20(23)26/h6-9,14-17H,2-5,10-13H2,1H3,(H,28,30) |
| InChIKey | ZHUMEQKJRABJDU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|