C34H36F2N4O5 — CID 59791979
N-[[3-fluoro-4-[6-methoxy-7-(4-piperidin-1-ylbutoxy)quinolin-4-yl]oxyphenyl]carbamoyl]-2-(4-fluorophenyl)acetamide (PubChem CID 59791979) has the molecular formula C34H36F2N4O5 and a molecular weight of 618.68 g/mol. Its IUPAC name is N-[[3-fluoro-4-[6-methoxy-7-(4-piperidin-1-ylbutoxy)quinolin-4-yl]oxyphenyl]carbamoyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-[6-methoxy-7-(4-piperidin-1-ylbutoxy)quinolin-4-yl]oxyphenyl]carbamoyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 59791979 |
| Molecular Formula | C34H36F2N4O5 |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | N-[[3-fluoro-4-[6-methoxy-7-(4-piperidin-1-ylbutoxy)quinolin-4-yl]oxyphenyl]carbamoyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)NC(=O)Cc4ccc(F)cc4)cc3F)ccnc2cc1OCCCCN1CCCCC1 |
| InChI | InChI=1S/C34H36F2N4O5/c1-43-31-21-26-28(22-32(31)44-18-6-5-17-40-15-3-2-4-16-40)37-14-13-29(26)45-30-12-11-25(20-27(30)36)38-34(42)39-33(41)19-23-7-9-24(35)10-8-23/h7-14,20-22H,2-6,15-19H2,1H3,(H2,38,39,41,42) |
| InChIKey | ACZWWLHHQSTAGP-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|