C31H30F2N4O5S — CID 59791935
N-[[3-fluoro-4-[6-methoxy-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide (PubChem CID 59791935) has the molecular formula C31H30F2N4O5S and a molecular weight of 608.67 g/mol. Its IUPAC name is N-[[3-fluoro-4-[6-methoxy-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-[6-methoxy-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 59791935 |
| Molecular Formula | C31H30F2N4O5S |
| Molecular Weight | 608.67 g/mol |
| Exact Mass | 608.19 |
| IUPAC Name | N-[[3-fluoro-4-[6-methoxy-7-(2-morpholin-4-ylethoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=S)NC(=O)Cc4ccc(F)cc4)cc3F)ccnc2cc1OCCN1CCOCC1 |
| InChI | InChI=1S/C31H30F2N4O5S/c1-39-28-18-23-25(19-29(28)41-15-12-37-10-13-40-14-11-37)34-9-8-26(23)42-27-7-6-22(17-24(27)33)35-31(43)36-30(38)16-20-2-4-21(32)5-3-20/h2-9,17-19H,10-16H2,1H3,(H2,35,36,38,43) |
| InChIKey | XSZPMTYBTDBLEK-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.67 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|