C32H34N4O6S — CID 59864363
N-[[3-hydroxy-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide (PubChem CID 59864363) has the molecular formula C32H34N4O6S and a molecular weight of 602.71 g/mol. Its IUPAC name is N-[[3-hydroxy-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide.
| Compound Name | N-[[3-hydroxy-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 59864363 |
| Molecular Formula | C32H34N4O6S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | N-[[3-hydroxy-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]carbamothioyl]-2-phenylacetamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=S)NC(=O)Cc4ccccc4)cc3O)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C32H34N4O6S/c1-39-29-20-24-25(21-30(29)41-15-5-12-36-13-16-40-17-14-36)33-11-10-27(24)42-28-9-8-23(19-26(28)37)34-32(43)35-31(38)18-22-6-3-2-4-7-22/h2-4,6-11,19-21,37H,5,12-18H2,1H3,(H2,34,35,38,43) |
| InChIKey | JMVVZLMTVWDLTQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 114.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|