C33H34FN3O6 — CID 59791949
N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-oxo-4-phenylbutanamide (PubChem CID 59791949) has the molecular formula C33H34FN3O6 and a molecular weight of 587.65 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-oxo-4-phenylbutanamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-oxo-4-phenylbutanamide |
|---|---|
| PubChem CID | 59791949 |
| Molecular Formula | C33H34FN3O6 |
| Molecular Weight | 587.65 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-morpholin-4-ylpropoxy)quinolin-4-yl]oxyphenyl]-3-oxo-4-phenylbutanamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)CC(=O)Cc4ccccc4)cc3F)ccnc2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C33H34FN3O6/c1-40-31-21-26-28(22-32(31)42-15-5-12-37-13-16-41-17-14-37)35-11-10-29(26)43-30-9-8-24(19-27(30)34)36-33(39)20-25(38)18-23-6-3-2-4-7-23/h2-4,6-11,19,21-22H,5,12-18,20H2,1H3,(H,36,39) |
| InChIKey | VNRJPTYOIYPODE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.65 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|