C35H34F2N4O5 — CID 162650256
N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]acetamide (PubChem CID 162650256) has the molecular formula C35H34F2N4O5 and a molecular weight of 628.68 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]acetamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]acetamide |
|---|---|
| PubChem CID | 162650256 |
| Molecular Formula | C35H34F2N4O5 |
| Molecular Weight | 628.68 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]acetamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)Cc4ncc(-c5ccc(F)cc5)o4)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C35H34F2N4O5/c1-43-31-19-26-28(20-32(31)44-17-5-16-41-14-3-2-4-15-41)38-13-12-29(26)45-30-11-10-25(18-27(30)37)40-34(42)21-35-39-22-33(46-35)23-6-8-24(36)9-7-23/h6-13,18-20,22H,2-5,14-17,21H2,1H3,(H,40,42) |
| InChIKey | VPHMYUWBRQLWQL-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 98.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.68 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|