C34H35FN6O4 — CID 127051734
N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(2-methylphenyl)triazole-4-carboxamide (PubChem CID 127051734) has the molecular formula C34H35FN6O4 and a molecular weight of 610.69 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(2-methylphenyl)triazole-4-carboxamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(2-methylphenyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 127051734 |
| Molecular Formula | C34H35FN6O4 |
| Molecular Weight | 610.69 g/mol |
| Exact Mass | 610.27 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]-1-(2-methylphenyl)triazole-4-carboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)c4cn(-c5ccccc5C)nn4)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C34H35FN6O4/c1-23-9-4-5-10-29(23)41-22-28(38-39-41)34(42)37-24-11-12-31(26(35)19-24)45-30-13-14-36-27-21-33(32(43-2)20-25(27)30)44-18-8-17-40-15-6-3-7-16-40/h4-5,9-14,19-22H,3,6-8,15-18H2,1-2H3,(H,37,42) |
| InChIKey | YXJKOQCWVMSGQU-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.69 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|