C32H34FN5O4 — CID 172824198
1-benzylidene-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]urea (PubChem CID 172824198) has the molecular formula C32H34FN5O4 and a molecular weight of 571.65 g/mol. Its IUPAC name is 1-benzylidene-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]urea.
| Compound Name | 1-benzylidene-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]urea |
|---|---|
| PubChem CID | 172824198 |
| Molecular Formula | C32H34FN5O4 |
| Molecular Weight | 571.65 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | 1-benzylidene-3-[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyanilino]urea |
| SMILES | COc1cc2c(Oc3ccc(NNC(=O)N=Cc4ccccc4)cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C32H34FN5O4/c1-40-30-20-25-27(21-31(30)41-18-8-17-38-15-6-3-7-16-38)34-14-13-28(25)42-29-12-11-24(19-26(29)33)36-37-32(39)35-22-23-9-4-2-5-10-23/h2,4-5,9-14,19-22,36H,3,6-8,15-18H2,1H3,(H,37,39) |
| InChIKey | UQDXLGQLSWKOSF-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.65 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|