C31H35FN4O6S — CID 163866032
2-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]-N-methylbenzeneamine oxide (PubChem CID 163866032) has the molecular formula C31H35FN4O6S and a molecular weight of 610.71 g/mol. Its IUPAC name is 2-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]-N-methylbenzeneamine oxide.
| Compound Name | 2-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]-N-methylbenzeneamine oxide |
|---|---|
| PubChem CID | 163866032 |
| Molecular Formula | C31H35FN4O6S |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.23 |
| IUPAC Name | 2-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]-N-methylbenzeneamine oxide |
| SMILES | COc1cc2c(Oc3ccc(NS(=O)(=O)c4ccccc4[NH+](C)[O-])cc3F)ccnc2cc1OCCCN1CCCCC1 |
| InChI | InChI=1S/C31H35FN4O6S/c1-35(37)26-9-4-5-10-31(26)43(38,39)34-22-11-12-28(24(32)19-22)42-27-13-14-33-25-21-30(29(40-2)20-23(25)27)41-18-8-17-36-15-6-3-7-16-36/h4-5,9-14,19-21,34-35H,3,6-8,15-18H2,1-2H3 |
| InChIKey | PGRQVRLRWWCLCM-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 117.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|