C30H32FN3O7S2 — CID 67073830
methyl 3-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]thiophene-2-carboxylate (PubChem CID 67073830) has the molecular formula C30H32FN3O7S2 and a molecular weight of 629.73 g/mol. Its IUPAC name is methyl 3-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 67073830 |
| Molecular Formula | C30H32FN3O7S2 |
| Molecular Weight | 629.73 g/mol |
| Exact Mass | 629.17 |
| IUPAC Name | methyl 3-[[3-fluoro-4-[6-methoxy-7-(3-piperidin-1-ylpropoxy)quinolin-4-yl]oxyphenyl]sulfamoyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)Nc1ccc(Oc2ccnc3cc(OCCCN4CCCCC4)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C30H32FN3O7S2/c1-38-26-18-21-23(19-27(26)40-15-6-14-34-12-4-3-5-13-34)32-11-9-24(21)41-25-8-7-20(17-22(25)31)33-43(36,37)28-10-16-42-29(28)30(35)39-2/h7-11,16-19,33H,3-6,12-15H2,1-2H3 |
| InChIKey | DEOWGAWNGPTBNI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.73 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|