C29H34FN5O5S — CID 52913751
N-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-sulfonamide (PubChem CID 52913751) has the molecular formula C29H34FN5O5S and a molecular weight of 583.69 g/mol. Its IUPAC name is N-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-sulfonamide.
| Compound Name | N-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 52913751 |
| Molecular Formula | C29H34FN5O5S |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | N-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-1-methylpyrazole-3-sulfonamide |
| SMILES | COc1cc2c(Oc3ccc(NS(=O)(=O)c4ccn(C)n4)cc3F)ccnc2cc1OCCCN1CCCC(C)C1 |
| InChI | InChI=1S/C29H34FN5O5S/c1-20-6-4-12-35(19-20)13-5-15-39-28-18-24-22(17-27(28)38-3)25(9-11-31-24)40-26-8-7-21(16-23(26)30)33-41(36,37)29-10-14-34(2)32-29/h7-11,14,16-18,20,33H,4-6,12-13,15,19H2,1-3H3 |
| InChIKey | IKTOPCXIFHNXOK-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|