C31H35F2N4O5S+ — CID 143878401
(4-amino-2-fluorophenyl)sulfonyl-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]azanium (PubChem CID 143878401) has the molecular formula C31H35F2N4O5S+ and a molecular weight of 613.71 g/mol. Its IUPAC name is (4-amino-2-fluorophenyl)sulfonyl-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]azanium.
| Compound Name | (4-amino-2-fluorophenyl)sulfonyl-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]azanium |
|---|---|
| PubChem CID | 143878401 |
| Molecular Formula | C31H35F2N4O5S+ |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | (4-amino-2-fluorophenyl)sulfonyl-[3-fluoro-4-[6-methoxy-7-[3-(3-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]azanium |
| SMILES | COc1cc2c(Oc3ccc([NH2+]S(=O)(=O)c4ccc(N)cc4F)cc3F)ccnc2cc1OCCCN1CCCC(C)C1 |
| InChI | InChI=1S/C31H34F2N4O5S/c1-20-5-3-12-37(19-20)13-4-14-41-30-18-26-23(17-29(30)40-2)27(10-11-35-26)42-28-8-7-22(16-24(28)32)36-43(38,39)31-9-6-21(34)15-25(31)33/h6-11,15-18,20,36H,3-5,12-14,19,34H2,1-2H3/p+1 |
| InChIKey | MYKFJKBTCSYHEO-UHFFFAOYSA-O |
| XLogP | 4.98 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|