C27H32FN5O4 — CID 154290494
[[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]urea (PubChem CID 154290494) has the molecular formula C27H32FN5O4 and a molecular weight of 509.58 g/mol. Its IUPAC name is [[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]urea.
| Compound Name | [[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 154290494 |
| Molecular Formula | C27H32FN5O4 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | [[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]methylideneamino]urea |
| SMILES | COc1cc2c(Oc3ccc(C=NNC(N)=O)cc3F)ccnc2cc1OCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C27H32FN5O4/c1-18-7-11-33(12-8-18)10-3-13-36-26-16-22-20(15-25(26)35-2)23(6-9-30-22)37-24-5-4-19(14-21(24)28)17-31-32-27(29)34/h4-6,9,14-18H,3,7-8,10-13H2,1-2H3,(H3,29,32,34) |
| InChIKey | PQVWYVHZMATKNU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|