C35H38FN3O7S — CID 134143222
(E)-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-(2-methoxyphenyl)sulfonylprop-2-enamide (PubChem CID 134143222) has the molecular formula C35H38FN3O7S and a molecular weight of 663.77 g/mol. Its IUPAC name is (E)-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-(2-methoxyphenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-(2-methoxyphenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 134143222 |
| Molecular Formula | C35H38FN3O7S |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | (E)-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-(2-methoxyphenyl)sulfonylprop-2-enamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)/C=C/S(=O)(=O)c4ccccc4OC)cc3F)ccnc2cc1OCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C35H38FN3O7S/c1-24-12-17-39(18-13-24)16-6-19-45-33-23-28-26(22-32(33)44-3)29(11-15-37-28)46-30-10-9-25(21-27(30)36)38-35(40)14-20-47(41,42)34-8-5-4-7-31(34)43-2/h4-5,7-11,14-15,20-24H,6,12-13,16-19H2,1-3H3,(H,38,40)/b20-14+ |
| InChIKey | CVUQYQVIPGUKSJ-XSFVSMFZSA-N |
| XLogP | 6.61 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|