C36H42ClFN4O6S — CID 162671168
N'-[(4-chlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide (PubChem CID 162671168) has the molecular formula C36H42ClFN4O6S and a molecular weight of 713.27 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide.
| Compound Name | N'-[(4-chlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide |
|---|---|
| PubChem CID | 162671168 |
| Molecular Formula | C36H42ClFN4O6S |
| Molecular Weight | 713.27 g/mol |
| Exact Mass | 712.25 |
| IUPAC Name | N'-[(4-chlorophenyl)methylsulfonyl]-N-[3-fluoro-4-[6-methoxy-7-[3-(4-methylpiperidin-1-yl)propoxy]quinolin-4-yl]oxyphenyl]-3-methoxypropanimidamide |
| SMILES | COCC/C(=N\S(=O)(=O)Cc1ccc(Cl)cc1)Nc1ccc(Oc2ccnc3cc(OCCCN4CCC(C)CC4)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C36H42ClFN4O6S/c1-25-12-17-42(18-13-25)16-4-19-47-35-23-31-29(22-34(35)46-3)32(11-15-39-31)48-33-10-9-28(21-30(33)38)40-36(14-20-45-2)41-49(43,44)24-26-5-7-27(37)8-6-26/h5-11,15,21-23,25H,4,12-14,16-20,24H2,1-3H3,(H,40,41) |
| InChIKey | ZONTZIAQXYDRJS-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 111.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.27 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|