C32H28FN3O5S — CID 162674405
N'-benzylsulfonyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-2-phenylethanimidamide (PubChem CID 162674405) has the molecular formula C32H28FN3O5S and a molecular weight of 585.66 g/mol. Its IUPAC name is N'-benzylsulfonyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-2-phenylethanimidamide.
| Compound Name | N'-benzylsulfonyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-2-phenylethanimidamide |
|---|---|
| PubChem CID | 162674405 |
| Molecular Formula | C32H28FN3O5S |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.17 |
| IUPAC Name | N'-benzylsulfonyl-N-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-2-phenylethanimidamide |
| SMILES | COc1cc2nccc(Oc3ccc(N/C(Cc4ccccc4)=N\S(=O)(=O)Cc4ccccc4)cc3F)c2cc1OC |
| InChI | InChI=1S/C32H28FN3O5S/c1-39-30-19-25-27(20-31(30)40-2)34-16-15-28(25)41-29-14-13-24(18-26(29)33)35-32(17-22-9-5-3-6-10-22)36-42(37,38)21-23-11-7-4-8-12-23/h3-16,18-20H,17,21H2,1-2H3,(H,35,36) |
| InChIKey | FYULUCXWGFEWGX-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 99.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|