C19H19FN2O3 — CID 67457884
4-(6,7-dimethoxyquinolin-4-yl)oxy-N-ethyl-3-fluoroaniline (PubChem CID 67457884) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is 4-(6,7-dimethoxyquinolin-4-yl)oxy-N-ethyl-3-fluoroaniline.
| Compound Name | 4-(6,7-dimethoxyquinolin-4-yl)oxy-N-ethyl-3-fluoroaniline |
|---|---|
| PubChem CID | 67457884 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 4-(6,7-dimethoxyquinolin-4-yl)oxy-N-ethyl-3-fluoroaniline |
| SMILES | CCNc1ccc(Oc2ccnc3cc(OC)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C19H19FN2O3/c1-4-21-12-5-6-17(14(20)9-12)25-16-7-8-22-15-11-19(24-3)18(23-2)10-13(15)16/h5-11,21H,4H2,1-3H3 |
| InChIKey | JLVVTPPUBQVIEP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |