C21H21FN2O4 — CID 155184797
N-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide (PubChem CID 155184797) has the molecular formula C21H21FN2O4 and a molecular weight of 384.41 g/mol. Its IUPAC name is N-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide.
| Compound Name | N-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide |
|---|---|
| PubChem CID | 155184797 |
| Molecular Formula | C21H21FN2O4 |
| Molecular Weight | 384.41 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-[4-(7-butoxy-6-methoxyquinolin-4-yl)oxy-3-fluorophenyl]formamide |
| SMILES | CCCCOc1cc2nccc(Oc3ccc(NC=O)cc3F)c2cc1OC |
| InChI | InChI=1S/C21H21FN2O4/c1-3-4-9-27-21-12-17-15(11-20(21)26-2)18(7-8-23-17)28-19-6-5-14(24-13-25)10-16(19)22/h5-8,10-13H,3-4,9H2,1-2H3,(H,24,25) |
| InChIKey | DGONPPLTUQYQTO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|