C30H26BrF2N3O5 — CID 164779111
1-N'-[4-[7-(3-bromopropoxy)-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 164779111) has the molecular formula C30H26BrF2N3O5 and a molecular weight of 626.45 g/mol. Its IUPAC name is 1-N'-[4-[7-(3-bromopropoxy)-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[7-(3-bromopropoxy)-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 164779111 |
| Molecular Formula | C30H26BrF2N3O5 |
| Molecular Weight | 626.45 g/mol |
| Exact Mass | 625.10 |
| IUPAC Name | 1-N'-[4-[7-(3-bromopropoxy)-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCCCBr |
| InChI | InChI=1S/C30H26BrF2N3O5/c1-39-26-16-21-23(17-27(26)40-14-2-12-31)34-13-9-24(21)41-25-8-7-20(15-22(25)33)36-29(38)30(10-11-30)28(37)35-19-5-3-18(32)4-6-19/h3-9,13,15-17H,2,10-12,14H2,1H3,(H,35,37)(H,36,38) |
| InChIKey | YBLQUEBMQNUWKQ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.45 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|