C29H24F2N4O7 — CID 71465577
1-N'-[3-fluoro-4-[6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 71465577) has the molecular formula C29H24F2N4O7 and a molecular weight of 578.53 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 71465577 |
| Molecular Formula | C29H24F2N4O7 |
| Molecular Weight | 578.53 g/mol |
| Exact Mass | 578.16 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-[2-(hydroxyamino)-2-oxoethoxy]-7-methoxyquinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)c2cc1OCC(=O)NO |
| InChI | InChI=1S/C29H24F2N4O7/c1-40-24-14-21-19(13-25(24)41-15-26(36)35-39)22(8-11-32-21)42-23-7-6-18(12-20(23)31)34-28(38)29(9-10-29)27(37)33-17-4-2-16(30)3-5-17/h2-8,11-14,39H,9-10,15H2,1H3,(H,33,37)(H,34,38)(H,35,36) |
| InChIKey | BYZVPQSTYSPOIV-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|