C28H23F2N3O6 — CID 90435587
1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-N-(4-fluoro-3-hydroxyphenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 90435587) has the molecular formula C28H23F2N3O6 and a molecular weight of 535.50 g/mol. Its IUPAC name is 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-N-(4-fluoro-3-hydroxyphenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-N-(4-fluoro-3-hydroxyphenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 90435587 |
| Molecular Formula | C28H23F2N3O6 |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 535.16 |
| IUPAC Name | 1-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]-1-N-(4-fluoro-3-hydroxyphenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)c(O)c5)CC4)cc3F)c2cc1OC |
| InChI | InChI=1S/C28H23F2N3O6/c1-37-24-13-17-20(14-25(24)38-2)31-10-7-22(17)39-23-6-4-15(11-19(23)30)32-26(35)28(8-9-28)27(36)33-16-3-5-18(29)21(34)12-16/h3-7,10-14,34H,8-9H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | VPSNYJWKZPMSMU-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|