C34H34FN3O5 — CID 71106026
1-N'-[3-fluoro-4-[6-methoxy-7-[3-(1-methylcyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 71106026) has the molecular formula C34H34FN3O5 and a molecular weight of 583.66 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-methoxy-7-[3-(1-methylcyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-(1-methylcyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 71106026 |
| Molecular Formula | C34H34FN3O5 |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-(1-methylcyclopropyl)propoxy]quinolin-4-yl]oxyphenyl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccccc5)CC4)cc3F)ccnc2cc1OCCCC1(C)CC1 |
| InChI | InChI=1S/C34H34FN3O5/c1-33(13-14-33)12-6-18-42-30-21-26-24(20-29(30)41-2)27(11-17-36-26)43-28-10-9-23(19-25(28)35)38-32(40)34(15-16-34)31(39)37-22-7-4-3-5-8-22/h3-5,7-11,17,19-21H,6,12-16,18H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | UHPJNNSQOYYGLJ-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 98.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|