C35H36F2N4O7 — CID 89471054
tert-butyl N-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxypropyl]carbamate (PubChem CID 89471054) has the molecular formula C35H36F2N4O7 and a molecular weight of 662.69 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxypropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 89471054 |
| Molecular Formula | C35H36F2N4O7 |
| Molecular Weight | 662.69 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | tert-butyl N-[3-[4-[2-fluoro-4-[[1-[(4-fluorophenyl)carbamoyl]cyclopropanecarbonyl]amino]phenoxy]-6-methoxyquinolin-7-yl]oxypropyl]carbamate |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H36F2N4O7/c1-34(2,3)48-33(44)39-15-5-17-46-30-20-26-24(19-29(30)45-4)27(12-16-38-26)47-28-11-10-23(18-25(28)37)41-32(43)35(13-14-35)31(42)40-22-8-6-21(36)7-9-22/h6-12,16,18-20H,5,13-15,17H2,1-4H3,(H,39,44)(H,40,42)(H,41,43) |
| InChIKey | FXKBSCDIBKNWCH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 137.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.69 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|