C34H35F2N5O6 — CID 139403816
1-N'-[3-fluoro-4-[6-methoxy-7-[3-(morpholin-4-ylamino)propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 139403816) has the molecular formula C34H35F2N5O6 and a molecular weight of 647.68 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-methoxy-7-[3-(morpholin-4-ylamino)propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-(morpholin-4-ylamino)propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 139403816 |
| Molecular Formula | C34H35F2N5O6 |
| Molecular Weight | 647.68 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[3-(morpholin-4-ylamino)propoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCCCNN1CCOCC1 |
| InChI | InChI=1S/C34H35F2N5O6/c1-44-30-20-25-27(21-31(30)46-16-2-12-38-41-14-17-45-18-15-41)37-13-9-28(25)47-29-8-7-24(19-26(29)36)40-33(43)34(10-11-34)32(42)39-23-5-3-22(35)4-6-23/h3-9,13,19-21,38H,2,10-12,14-18H2,1H3,(H,39,42)(H,40,43) |
| InChIKey | AACOYZJNSRJDLQ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 123.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.68 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|