C33H32F2N4O6S — CID 164779116
1-N'-[3-fluoro-4-[6-methoxy-7-[4-[(2-sulfanylacetyl)amino]butoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 164779116) has the molecular formula C33H32F2N4O6S and a molecular weight of 650.70 g/mol. Its IUPAC name is 1-N'-[3-fluoro-4-[6-methoxy-7-[4-[(2-sulfanylacetyl)amino]butoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[4-[(2-sulfanylacetyl)amino]butoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 164779116 |
| Molecular Formula | C33H32F2N4O6S |
| Molecular Weight | 650.70 g/mol |
| Exact Mass | 650.20 |
| IUPAC Name | 1-N'-[3-fluoro-4-[6-methoxy-7-[4-[(2-sulfanylacetyl)amino]butoxy]quinolin-4-yl]oxyphenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCCCCNC(=O)CS |
| InChI | InChI=1S/C33H32F2N4O6S/c1-43-28-17-23-25(18-29(28)44-15-3-2-13-37-30(40)19-46)36-14-10-26(23)45-27-9-8-22(16-24(27)35)39-32(42)33(11-12-33)31(41)38-21-6-4-20(34)5-7-21/h4-10,14,16-18,46H,2-3,11-13,15,19H2,1H3,(H,37,40)(H,38,41)(H,39,42) |
| InChIKey | POSANWIXLCRAIK-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.70 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|