C28H25F3N2O7S — CID 67959157
4-[4-[4-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxybutyl acetate (PubChem CID 67959157) has the molecular formula C28H25F3N2O7S and a molecular weight of 590.58 g/mol. Its IUPAC name is 4-[4-[4-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxybutyl acetate.
| Compound Name | 4-[4-[4-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxybutyl acetate |
|---|---|
| PubChem CID | 67959157 |
| Molecular Formula | C28H25F3N2O7S |
| Molecular Weight | 590.58 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 4-[4-[4-[(2,5-difluorophenyl)sulfonylamino]-2-fluorophenoxy]-6-methoxyquinolin-7-yl]oxybutyl acetate |
| SMILES | COc1cc2c(Oc3ccc(NS(=O)(=O)c4cc(F)ccc4F)cc3F)ccnc2cc1OCCCCOC(C)=O |
| InChI | InChI=1S/C28H25F3N2O7S/c1-17(34)38-11-3-4-12-39-27-16-23-20(15-26(27)37-2)24(9-10-32-23)40-25-8-6-19(14-22(25)31)33-41(35,36)28-13-18(29)5-7-21(28)30/h5-10,13-16,33H,3-4,11-12H2,1-2H3 |
| InChIKey | ZOQZVPVEWCBLAJ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 113.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.58 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|