C29H28F3N3O5S — CID 52914194
2,5-difluoro-N-[3-fluoro-4-[7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]benzenesulfonamide (PubChem CID 52914194) has the molecular formula C29H28F3N3O5S and a molecular weight of 587.62 g/mol. Its IUPAC name is 2,5-difluoro-N-[3-fluoro-4-[7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]benzenesulfonamide.
| Compound Name | 2,5-difluoro-N-[3-fluoro-4-[7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 52914194 |
| Molecular Formula | C29H28F3N3O5S |
| Molecular Weight | 587.62 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | 2,5-difluoro-N-[3-fluoro-4-[7-(4-morpholin-4-ylbutoxy)quinolin-4-yl]oxyphenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(Oc2ccnc3cc(OCCCCN4CCOCC4)ccc23)c(F)c1)c1cc(F)ccc1F |
| InChI | InChI=1S/C29H28F3N3O5S/c30-20-3-7-24(31)29(17-20)41(36,37)34-21-4-8-28(25(32)18-21)40-27-9-10-33-26-19-22(5-6-23(26)27)39-14-2-1-11-35-12-15-38-16-13-35/h3-10,17-19,34H,1-2,11-16H2 |
| InChIKey | WBFOVGSAIXHYPF-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|