C34H43FN4O5 — CID 130443570
N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-N-[(4Z,6Z)-nona-4,6-dienyl]oxamide (PubChem CID 130443570) has the molecular formula C34H43FN4O5 and a molecular weight of 606.74 g/mol. Its IUPAC name is N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-N-[(4Z,6Z)-nona-4,6-dienyl]oxamide.
| Compound Name | N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-N-[(4Z,6Z)-nona-4,6-dienyl]oxamide |
|---|---|
| PubChem CID | 130443570 |
| Molecular Formula | C34H43FN4O5 |
| Molecular Weight | 606.74 g/mol |
| Exact Mass | 606.32 |
| IUPAC Name | N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-N-[(4Z,6Z)-nona-4,6-dienyl]oxamide |
| SMILES | CC/C=C\C=C/CCCNC(=O)C(=O)Nc1ccc(Oc2ccnc3cc(OCCCN(CC)CC)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C34H43FN4O5/c1-5-8-9-10-11-12-13-18-37-33(40)34(41)38-25-15-16-30(27(35)22-25)44-29-17-19-36-28-24-32(31(42-4)23-26(28)29)43-21-14-20-39(6-2)7-3/h8-11,15-17,19,22-24H,5-7,12-14,18,20-21H2,1-4H3,(H,37,40)(H,38,41)/b9-8-,11-10- |
| InChIKey | NZJHWZDPBVZTBU-XESWYYRISA-N |
| XLogP | 6.64 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|