C35H38F2N4O5 — CID 76617955
1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide (PubChem CID 76617955) has the molecular formula C35H38F2N4O5 and a molecular weight of 632.71 g/mol. Its IUPAC name is 1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 76617955 |
| Molecular Formula | C35H38F2N4O5 |
| Molecular Weight | 632.71 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 1-N'-[4-[7-[3-(diethylamino)propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)-2-methylcyclopropane-1,1-dicarboxamide |
| SMILES | CCN(CC)CCCOc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4C)cc3F)c2cc1OC |
| InChI | InChI=1S/C35H38F2N4O5/c1-5-41(6-2)16-7-17-45-32-20-28-26(19-31(32)44-4)29(14-15-38-28)46-30-13-12-25(18-27(30)37)40-34(43)35(21-22(35)3)33(42)39-24-10-8-23(36)9-11-24/h8-15,18-20,22H,5-7,16-17,21H2,1-4H3,(H,39,42)(H,40,43) |
| InChIKey | OHPWACHGLPAXRD-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.71 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|