C36H41F2N4O10PS — CID 56598358
1-N'-[4-[7-[3-[diethoxyphosphorylmethyl(methylsulfonyl)amino]propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 56598358) has the molecular formula C36H41F2N4O10PS and a molecular weight of 790.78 g/mol. Its IUPAC name is 1-N'-[4-[7-[3-[diethoxyphosphorylmethyl(methylsulfonyl)amino]propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[7-[3-[diethoxyphosphorylmethyl(methylsulfonyl)amino]propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 56598358 |
| Molecular Formula | C36H41F2N4O10PS |
| Molecular Weight | 790.78 g/mol |
| Exact Mass | 790.22 |
| IUPAC Name | 1-N'-[4-[7-[3-[diethoxyphosphorylmethyl(methylsulfonyl)amino]propoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCOP(=O)(CN(CCCOc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)c2cc1OC)S(C)(=O)=O)OCC |
| InChI | InChI=1S/C36H41F2N4O10PS/c1-5-50-53(45,51-6-2)23-42(54(4,46)47)18-7-19-49-33-22-29-27(21-32(33)48-3)30(14-17-39-29)52-31-13-12-26(20-28(31)38)41-35(44)36(15-16-36)34(43)40-25-10-8-24(37)9-11-25/h8-14,17,20-22H,5-7,15-16,18-19,23H2,1-4H3,(H,40,43)(H,41,44) |
| InChIKey | HIQLDGSMQSWIAC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 171.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.78 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|