C36H39F2N4O9P — CID 56597644
1-N'-[4-[7-[2-[acetyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 56597644) has the molecular formula C36H39F2N4O9P and a molecular weight of 740.70 g/mol. Its IUPAC name is 1-N'-[4-[7-[2-[acetyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[7-[2-[acetyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 56597644 |
| Molecular Formula | C36H39F2N4O9P |
| Molecular Weight | 740.70 g/mol |
| Exact Mass | 740.24 |
| IUPAC Name | 1-N'-[4-[7-[2-[acetyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCOP(=O)(CN(CCOc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)c2cc1OC)C(C)=O)OCC |
| InChI | InChI=1S/C36H39F2N4O9P/c1-5-49-52(46,50-6-2)22-42(23(3)43)17-18-48-33-21-29-27(20-32(33)47-4)30(13-16-39-29)51-31-12-11-26(19-28(31)38)41-35(45)36(14-15-36)34(44)40-25-9-7-24(37)8-10-25/h7-13,16,19-21H,5-6,14-15,17-18,22H2,1-4H3,(H,40,44)(H,41,45) |
| InChIKey | WBOPVFVZHCKOHE-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 154.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|