C35H38F2N5O9P — CID 56597947
1-N'-[4-[7-[2-[carbamoyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 56597947) has the molecular formula C35H38F2N5O9P and a molecular weight of 741.68 g/mol. Its IUPAC name is 1-N'-[4-[7-[2-[carbamoyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[7-[2-[carbamoyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 56597947 |
| Molecular Formula | C35H38F2N5O9P |
| Molecular Weight | 741.68 g/mol |
| Exact Mass | 741.24 |
| IUPAC Name | 1-N'-[4-[7-[2-[carbamoyl(diethoxyphosphorylmethyl)amino]ethoxy]-6-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-1-N-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCOP(=O)(CN(CCOc1cc2nccc(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)c2cc1OC)C(N)=O)OCC |
| InChI | InChI=1S/C35H38F2N5O9P/c1-4-49-52(46,50-5-2)21-42(34(38)45)16-17-48-31-20-27-25(19-30(31)47-3)28(12-15-39-27)51-29-11-10-24(18-26(29)37)41-33(44)35(13-14-35)32(43)40-23-8-6-22(36)7-9-23/h6-12,15,18-20H,4-5,13-14,16-17,21H2,1-3H3,(H2,38,45)(H,40,43)(H,41,44) |
| InChIKey | QZOSROZWSYBAIK-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 180.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|