C34H36F2N4O5 — CID 123473274
1-N'-[4-[6-[3-(diethylamino)propoxy]-7-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-2-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide (PubChem CID 123473274) has the molecular formula C34H36F2N4O5 and a molecular weight of 618.68 g/mol. Its IUPAC name is 1-N'-[4-[6-[3-(diethylamino)propoxy]-7-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-2-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[4-[6-[3-(diethylamino)propoxy]-7-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-2-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 123473274 |
| Molecular Formula | C34H36F2N4O5 |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.27 |
| IUPAC Name | 1-N'-[4-[6-[3-(diethylamino)propoxy]-7-methoxyquinolin-4-yl]oxy-3-fluorophenyl]-2-(4-fluorophenyl)cyclopropane-1,1-dicarboxamide |
| SMILES | CCN(CC)CCCOc1cc2c(Oc3ccc(NC(=O)C4(C(N)=O)CC4c4ccc(F)cc4)cc3F)ccnc2cc1OC |
| InChI | InChI=1S/C34H36F2N4O5/c1-4-40(5-2)15-6-16-44-31-18-24-27(19-30(31)43-3)38-14-13-28(24)45-29-12-11-23(17-26(29)36)39-33(42)34(32(37)41)20-25(34)21-7-9-22(35)10-8-21/h7-14,17-19,25H,4-6,15-16,20H2,1-3H3,(H2,37,41)(H,39,42) |
| InChIKey | WZFNSMRHNHDIJC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|