C29H27ClFN5O7 — CID 69052259
N-[2-(4-chlorophenyl)ethyl]-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]oxamide;oxamide (PubChem CID 69052259) has the molecular formula C29H27ClFN5O7 and a molecular weight of 612.01 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]oxamide;oxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]oxamide;oxamide |
|---|---|
| PubChem CID | 69052259 |
| Molecular Formula | C29H27ClFN5O7 |
| Molecular Weight | 612.01 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-N'-[4-(6,7-dimethoxyquinolin-4-yl)oxy-3-fluorophenyl]oxamide;oxamide |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)C(=O)NCCc4ccc(Cl)cc4)cc3F)c2cc1OC.NC(=O)C(N)=O |
| InChI | InChI=1S/C27H23ClFN3O5.C2H4N2O2/c1-35-24-14-19-21(15-25(24)36-2)30-12-10-22(19)37-23-8-7-18(13-20(23)29)32-27(34)26(33)31-11-9-16-3-5-17(28)6-4-16;3-1(5)2(4)6/h3-8,10,12-15H,9,11H2,1-2H3,(H,31,33)(H,32,34);(H2,3,5)(H2,4,6) |
| InChIKey | LLTUKOKXJJGJNR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 184.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.01 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|