C33H35FN4O5 — CID 58830571
N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-[2-(3-methylphenyl)ethyl]oxamide (PubChem CID 58830571) has the molecular formula C33H35FN4O5 and a molecular weight of 586.66 g/mol. Its IUPAC name is N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-[2-(3-methylphenyl)ethyl]oxamide.
| Compound Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-[2-(3-methylphenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 58830571 |
| Molecular Formula | C33H35FN4O5 |
| Molecular Weight | 586.66 g/mol |
| Exact Mass | 586.26 |
| IUPAC Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-[2-(3-methylphenyl)ethyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C(=O)NCCc4cccc(C)c4)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C33H35FN4O5/c1-21-4-3-5-22(16-21)10-14-37-32(39)33(40)38-24-6-7-29(26(34)17-24)43-28-11-15-36-27-19-31(30(41-2)18-25(27)28)42-20-23-8-12-35-13-9-23/h3-7,11,15-19,23,35H,8-10,12-14,20H2,1-2H3,(H,37,39)(H,38,40) |
| InChIKey | ATASJNOGUCGHLC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|