C28H31FN4O5 — CID 135350072
N-(cyclopropylmethyl)-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 135350072) has the molecular formula C28H31FN4O5 and a molecular weight of 522.58 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N-(cyclopropylmethyl)-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 135350072 |
| Molecular Formula | C28H31FN4O5 |
| Molecular Weight | 522.58 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-(cyclopropylmethyl)-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1c(OCC2CCNCC2)ccc2c(Oc3ccc(NC(=O)C(=O)NCC4CC4)cc3F)ccnc12 |
| InChI | InChI=1S/C28H31FN4O5/c1-36-26-24(37-16-18-8-11-30-12-9-18)7-5-20-22(10-13-31-25(20)26)38-23-6-4-19(14-21(23)29)33-28(35)27(34)32-15-17-2-3-17/h4-7,10,13-14,17-18,30H,2-3,8-9,11-12,15-16H2,1H3,(H,32,34)(H,33,35) |
| InChIKey | VVJNMXJXBHIVQN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|