C30H37FN4O5 — CID 143025998
N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-hexyloxamide (PubChem CID 143025998) has the molecular formula C30H37FN4O5 and a molecular weight of 552.65 g/mol. Its IUPAC name is N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-hexyloxamide.
| Compound Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-hexyloxamide |
|---|---|
| PubChem CID | 143025998 |
| Molecular Formula | C30H37FN4O5 |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-hexyloxamide |
| SMILES | CCCCCCNC(=O)C(=O)Nc1ccc(Oc2ccnc3cc(OCC4CCNCC4)c(OC)cc23)c(F)c1 |
| InChI | InChI=1S/C30H37FN4O5/c1-3-4-5-6-12-34-29(36)30(37)35-21-7-8-26(23(31)16-21)40-25-11-15-33-24-18-28(27(38-2)17-22(24)25)39-19-20-9-13-32-14-10-20/h7-8,11,15-18,20,32H,3-6,9-10,12-14,19H2,1-2H3,(H,34,36)(H,35,37) |
| InChIKey | CGQYRTCUNQTTMK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|