C25H26FN3O6 — CID 66669350
2-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyanilino]-2-oxoacetic acid (PubChem CID 66669350) has the molecular formula C25H26FN3O6 and a molecular weight of 483.50 g/mol. Its IUPAC name is 2-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyanilino]-2-oxoacetic acid.
| Compound Name | 2-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 66669350 |
| Molecular Formula | C25H26FN3O6 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyanilino]-2-oxoacetic acid |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C(=O)O)cc3F)ccnc2cc1OC(C)C1CCNCC1 |
| InChI | InChI=1S/C25H26FN3O6/c1-14(15-5-8-27-9-6-15)34-23-13-19-17(12-22(23)33-2)20(7-10-28-19)35-21-4-3-16(11-18(21)26)29-24(30)25(31)32/h3-4,7,10-15,27H,5-6,8-9H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | RYOZOGZZILHEJK-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|