C32H35FN4O5 — CID 167073128
N-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 167073128) has the molecular formula C32H35FN4O5 and a molecular weight of 574.65 g/mol. Its IUPAC name is N-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 167073128 |
| Molecular Formula | C32H35FN4O5 |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | N-(2-cyclohexa-1,5-dien-1-ylethyl)-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C(=O)NCCC4=CCCC=C4)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C32H35FN4O5/c1-40-29-18-24-26(19-30(29)41-20-22-9-13-34-14-10-22)35-16-12-27(24)42-28-8-7-23(17-25(28)33)37-32(39)31(38)36-15-11-21-5-3-2-4-6-21/h3,5-8,12,16-19,22,34H,2,4,9-11,13-15,20H2,1H3,(H,36,38)(H,37,39) |
| InChIKey | WVTILZZLYGXWJA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|