C34H37FN4O7 — CID 135350241
N-[2-(3,5-dimethoxyphenyl)ethyl]-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 135350241) has the molecular formula C34H37FN4O7 and a molecular weight of 632.69 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenyl)ethyl]-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N-[2-(3,5-dimethoxyphenyl)ethyl]-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 135350241 |
| Molecular Formula | C34H37FN4O7 |
| Molecular Weight | 632.69 g/mol |
| Exact Mass | 632.26 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenyl)ethyl]-N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc(CCNC(=O)C(=O)Nc2ccc(Oc3ccnc4c(OC)c(OCC5CCNCC5)ccc34)c(F)c2)cc(OC)c1 |
| InChI | InChI=1S/C34H37FN4O7/c1-42-24-16-22(17-25(19-24)43-2)10-14-38-33(40)34(41)39-23-4-6-29(27(35)18-23)46-28-11-15-37-31-26(28)5-7-30(32(31)44-3)45-20-21-8-12-36-13-9-21/h4-7,11,15-19,21,36H,8-10,12-14,20H2,1-3H3,(H,38,40)(H,39,41) |
| InChIKey | NKNBIBGURQFCDJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.69 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|