C33H34F2N4O5 — CID 135350119
N'-[3-fluoro-4-[8-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N-[2-(4-fluorophenyl)ethyl]oxamide (PubChem CID 135350119) has the molecular formula C33H34F2N4O5 and a molecular weight of 604.65 g/mol. Its IUPAC name is N'-[3-fluoro-4-[8-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N-[2-(4-fluorophenyl)ethyl]oxamide.
| Compound Name | N'-[3-fluoro-4-[8-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N-[2-(4-fluorophenyl)ethyl]oxamide |
|---|---|
| PubChem CID | 135350119 |
| Molecular Formula | C33H34F2N4O5 |
| Molecular Weight | 604.65 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | N'-[3-fluoro-4-[8-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinolin-4-yl]oxyphenyl]-N-[2-(4-fluorophenyl)ethyl]oxamide |
| SMILES | COc1c(OCC2CCN(C)CC2)ccc2c(Oc3ccc(NC(=O)C(=O)NCCc4ccc(F)cc4)cc3F)ccnc12 |
| InChI | InChI=1S/C33H34F2N4O5/c1-39-17-13-22(14-18-39)20-43-29-10-8-25-27(12-16-36-30(25)31(29)42-2)44-28-9-7-24(19-26(28)35)38-33(41)32(40)37-15-11-21-3-5-23(34)6-4-21/h3-10,12,16,19,22H,11,13-15,17-18,20H2,1-2H3,(H,37,40)(H,38,41) |
| InChIKey | CSXLEKHJQODKGQ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.65 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|