C32H31FN4O6 — CID 135350103
N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-phenacyloxamide (PubChem CID 135350103) has the molecular formula C32H31FN4O6 and a molecular weight of 586.62 g/mol. Its IUPAC name is N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-phenacyloxamide.
| Compound Name | N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-phenacyloxamide |
|---|---|
| PubChem CID | 135350103 |
| Molecular Formula | C32H31FN4O6 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | N'-[3-fluoro-4-[8-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]-N-phenacyloxamide |
| SMILES | COc1c(OCC2CCNCC2)ccc2c(Oc3ccc(NC(=O)C(=O)NCC(=O)c4ccccc4)cc3F)ccnc12 |
| InChI | InChI=1S/C32H31FN4O6/c1-41-30-28(42-19-20-11-14-34-15-12-20)10-8-23-26(13-16-35-29(23)30)43-27-9-7-22(17-24(27)33)37-32(40)31(39)36-18-25(38)21-5-3-2-4-6-21/h2-10,13,16-17,20,34H,11-12,14-15,18-19H2,1H3,(H,36,39)(H,37,40) |
| InChIKey | BRJRKCBBACWAGA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|