C34H37FN4O5 — CID 58830562
N-[2-(3,4-dimethylphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide (PubChem CID 58830562) has the molecular formula C34H37FN4O5 and a molecular weight of 600.69 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide.
| Compound Name | N-[2-(3,4-dimethylphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
|---|---|
| PubChem CID | 58830562 |
| Molecular Formula | C34H37FN4O5 |
| Molecular Weight | 600.69 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)ethyl]-N'-[3-fluoro-4-[6-methoxy-7-(piperidin-4-ylmethoxy)quinolin-4-yl]oxyphenyl]oxamide |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C(=O)NCCc4ccc(C)c(C)c4)cc3F)ccnc2cc1OCC1CCNCC1 |
| InChI | InChI=1S/C34H37FN4O5/c1-21-4-5-23(16-22(21)2)10-14-38-33(40)34(41)39-25-6-7-30(27(35)17-25)44-29-11-15-37-28-19-32(31(42-3)18-26(28)29)43-20-24-8-12-36-13-9-24/h4-7,11,15-19,24,36H,8-10,12-14,20H2,1-3H3,(H,38,40)(H,39,41) |
| InChIKey | FYIKCYGSQQXPSG-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 110.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.69 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|