C33H35FN4O6 — CID 66669362
N'-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyphenyl]-N-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 66669362) has the molecular formula C33H35FN4O6 and a molecular weight of 602.66 g/mol. Its IUPAC name is N'-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyphenyl]-N-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N'-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyphenyl]-N-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 66669362 |
| Molecular Formula | C33H35FN4O6 |
| Molecular Weight | 602.66 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | N'-[3-fluoro-4-[6-methoxy-7-(1-piperidin-4-ylethoxy)quinolin-4-yl]oxyphenyl]-N-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)Nc2ccc(Oc3ccnc4cc(OC(C)C5CCNCC5)c(OC)cc34)c(F)c2)cc1 |
| InChI | InChI=1S/C33H35FN4O6/c1-20(22-10-13-35-14-11-22)43-31-18-27-25(17-30(31)42-3)28(12-15-36-27)44-29-9-6-23(16-26(29)34)38-33(40)32(39)37-19-21-4-7-24(41-2)8-5-21/h4-9,12,15-18,20,22,35H,10-11,13-14,19H2,1-3H3,(H,37,39)(H,38,40) |
| InChIKey | VFZQNFJEWASTOM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 120.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.66 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|